Welcom to Sichuan Hengkang Science and Technology Development Co.,Ltd.
L-Serine benzyl ester HCL
Identification
| Name | L-serine benzyl ester hydrochloride |
| Synonyms | L-serine benzyl ester hcl(2S)-1-(benzyloxy)-3-hydroxy-1-oxopropan-2-aminium chloride
H-Ser-OBzl . HCl H-Ser-OBzl.HCL benzyl serinate hydrochloride H-Ser-Obzl Hcl H-Ser-OBzl·HCl |
| CAS | 60022-62-01738-72-3 |
| InChI | InChI=1/C10H13NO3.ClH/c11-9(6-12)10(13)14-7-8-4-2-1-3-5-8;/h1-5,9,12H,6-7,11H2;1H/t9-;/m0./s1 |
Physico-chemical Properties
| Molecular Formula | C10H14ClNO3 |
| Molar Mass | 231.676 g/mol |
| Boling Point | 360.4°C at 760 mmHg |
| Flash Point | 171.8°C |
| Vapor Presure | 8E-06mmHg at 25°C |
Product Specifications
1. Appearance/colour Off-white to White powder
2. Identification by HPLC Corresponds
3. Chemical purity(HPLC area) ≥97.0%
4. Assay(Titration w/w ) 98.0%~103.0%
5. Water（vol %w/w) ≤1.0%
